Difference between revisions of "2-METHYL-BUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-BUTYRYL-COA == * common-name: ** 2-methylbutanoyl-coa * smiles: ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PANTETHEINE-P ==
+
== Metabolite 2-METHYL-BUTYRYL-COA ==
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** 2-methylbutanoyl-coa
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
+
** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jdmuprlruumctl-vifpvbqesa-l
+
** lynvnydeqmmnmz-xgxnyeovsa-j
 
* molecular-weight:
 
* molecular-weight:
** 356.33
+
** 847.62
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[2-MEBUCOA-FAD-RXN]]
* [[PANTETHEINE-KINASE-RXN]]
+
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 +
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.14-RXN]]
+
* [[2-MEBUCOA-FAD-RXN]]
* [[P-PANTOCYSDECARB-RXN]]
+
* [[2KETO-3METHYLVALERATE-RXN]]
* [[PANTETHEINE-KINASE-RXN]]
+
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-phosphopantetheine}}
+
{{#set: common-name=2-methylbutanoyl-coa}}
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
+
{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
{{#set: molecular-weight=356.33}}
+
{{#set: molecular-weight=847.62}}

Latest revision as of 11:18, 18 March 2021

Metabolite 2-METHYL-BUTYRYL-COA

  • common-name:
    • 2-methylbutanoyl-coa
  • smiles:
    • ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lynvnydeqmmnmz-xgxnyeovsa-j
  • molecular-weight:
    • 847.62

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality