Difference between revisions of "2-METHYL-BUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] == * direction: ** left-to-right * common-name: ** lanosterol 14-hydroxylase *...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-BUTYRYL-COA == * common-name: ** 2-methylbutanoyl-coa * smiles: ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] ==
+
== Metabolite 2-METHYL-BUTYRYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lanosterol 14-hydroxylase
+
** 2-methylbutanoyl-coa
−
** lanosterol,nadph:oxygen oxidoreductase
+
* smiles:
−
== Reaction formula ==
+
** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* 1 [[LANOSTEROL]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-4568]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
* inchi-key:
−
== Gene(s) associated with this reaction  ==
+
** lynvnydeqmmnmz-xgxnyeovsa-j
−
* Gene: [[SJ05072]]
+
* molecular-weight:
−
** Category: [[annotation]]
+
** 847.62
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[2-MEBUCOA-FAD-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2KETO-3METHYLVALERATE-RXN]]
−
== Pathway(s) ==
+
* [[MBCOA-DHLIPOAMIDE-RXN]]
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
−
** '''14''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
* [[2-MEBUCOA-FAD-RXN]]
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
* [[2KETO-3METHYLVALERATE-RXN]]
−
== Reconstruction information  ==
+
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MBCOA-DHLIPOAMIDE-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=2-methylbutanoyl-coa}}
−
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
−
{{#set: common-name=lanosterol,nadph:oxygen oxidoreductase|lanosterol 14-hydroxylase}}
+
{{#set: molecular-weight=847.62}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite 2-METHYL-BUTYRYL-COA

  • common-name:
    • 2-methylbutanoyl-coa
  • smiles:
    • ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lynvnydeqmmnmz-xgxnyeovsa-j
  • molecular-weight:
    • 847.62

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-METHYL-BUTYRYL-COA&oldid=139803"