Difference between revisions of "2-METHYL-BUTYRYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Cytosines == * common-name: ** a cytosine in dna == Reaction(s) known to consume the compound == * 2.1.1.113-RXN * DNA-CYTOSINE...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-BUTYRYL-COA == * common-name: ** 2-methylbutanoyl-coa * smiles: ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-METHYL-BUTYRYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methylbutanoyl-coa |
+ | * smiles: | ||
+ | ** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** lynvnydeqmmnmz-xgxnyeovsa-j | ||
+ | * molecular-weight: | ||
+ | ** 847.62 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[2 | + | * [[2-MEBUCOA-FAD-RXN]] |
− | * [[ | + | * [[2KETO-3METHYLVALERATE-RXN]] |
+ | * [[MBCOA-DHLIPOAMIDE-RXN]] | ||
+ | * [[MCDH_LPAREN_2mb2coa_RPAREN_]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2-MEBUCOA-FAD-RXN]] | ||
+ | * [[2KETO-3METHYLVALERATE-RXN]] | ||
+ | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] | ||
+ | * [[MBCOA-DHLIPOAMIDE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methylbutanoyl-coa}} |
+ | {{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}} | ||
+ | {{#set: molecular-weight=847.62}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite 2-METHYL-BUTYRYL-COA
- common-name:
- 2-methylbutanoyl-coa
- smiles:
- ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- lynvnydeqmmnmz-xgxnyeovsa-j
- molecular-weight:
- 847.62