Difference between revisions of "2-METHYLMALEATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common-name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi-key: ** bjypzfuwwjsak...") |
(Created page with "Category:metabolite == Metabolite Ditrans-polycis-polyprenols == * common-name: ** a di-trans, poly-cis-polyprenol == Reaction(s) known to consume the compound == * RXN-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ditrans-polycis-polyprenols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a di-trans, poly-cis-polyprenol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9971]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a di-trans, poly-cis-polyprenol}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite Ditrans-polycis-polyprenols
- common-name:
- a di-trans, poly-cis-polyprenol
