Difference between revisions of "2-Me-Branched-234-Sat-FA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19161 == * common-name: ** (2e,7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-19161 ==
+
== Metabolite 2-Me-Branched-234-Sat-FA ==
 
* common-name:
 
* common-name:
−
** (2e,7z)-tetradecenoyl-coa
+
** a 2-methyl branched 2,3,4-saturated fatty acid
−
* smiles:
 
−
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** mwksuvqqmpjtpp-dtpvmwfysa-j
 
−
* molecular-weight:
 
−
** 969.83
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17793]]
+
* [[RXN66-483]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17792]]
+
* [[RXN66-472]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acid}}
−
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
 
−
{{#set: molecular-weight=969.83}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2-Me-Branched-234-Sat-FA

  • common-name:
    • a 2-methyl branched 2,3,4-saturated fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-Me-Branched-234-Sat-FA&oldid=139618"