Difference between revisions of "2-Me-Branched-234-Sat-FA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
(Created page with "Category:metabolite == Metabolite CIS-DELTA3-ENOYL-COA == * common-name: ** a (3z)-alkan-3-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-DELTA-IS...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CIS-DELTA3-ENOYL-COA == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** a (3z)-alkan-3-enoyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ENOYL-COA-DELTA-ISOM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ENOYL-COA-DELTA-ISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=a (3z)-alkan-3-enoyl-coa}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite CIS-DELTA3-ENOYL-COA
- common-name:
- a (3z)-alkan-3-enoyl-coa
