Difference between revisions of "2-Me-Branched-234-Sat-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CTP == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to cons...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CTP ==
+
== Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** ctp
+
** a 2-methyl branched 2,3,4-saturated fatty acyl-coa
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
 
* inchi-key:
 
** pcdqprrszkqhhs-xvfcmesisa-j
 
* molecular-weight:
 
** 479.127
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.14-RXN]]
 
* [[2.7.7.15-RXN]]
 
* [[2.7.7.60-RXN]]
 
* [[CDPDIGLYSYN-RXN]]
 
* [[CHLPCTDh]]
 
* [[DOLICHOL-KINASE-RXN]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[RXN-12195]]
 
* [[RXN-12200]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
* [[RXN0-383]]
 
* [[RXN0-5515]]
 
* [[RXN0-723]]
 
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATCD]]
+
* [[RXN66-483]]
* [[ATCDm]]
 
* [[CDPKIN-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[RXN-14325]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ctp}}
+
{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acyl-coa}}
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
 
{{#set: molecular-weight=479.127}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA

  • common-name:
    • a 2-methyl branched 2,3,4-saturated fatty acyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality