Difference between revisions of "2-Me-Branched-234-Sat-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to cons...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12902 ==
+
== Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** 5-methylhex-4-enoyl-coa
+
** a 2-methyl branched 2,3,4-saturated fatty acyl-coa
* smiles:
 
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** beyylhumfmwplh-svhodsnwsa-j
 
* molecular-weight:
 
** 873.658
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
+
* [[RXN66-483]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acyl-coa}}
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
 
{{#set: molecular-weight=873.658}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2-Me-Branched-234-Sat-Fatty-Acyl-CoA

  • common-name:
    • a 2-methyl branched 2,3,4-saturated fatty acyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality