Difference between revisions of "2-O-MeCytidine4-tRNAGLY-GCC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite DNA-thymidines == * common-name: ** a thymidine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce th...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-thymidines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a thymidine in dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a thymidine in dna}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite DNA-thymidines
- common-name:
- a thymidine in dna
