Difference between revisions of "2-O-MeGuan-34-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8167 == * common-name: ** 1-18:3-2-18:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1)...")
(Created page with "Category:metabolite == Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE == * common-name: ** 5-amino-6-(d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8167 ==
+
== Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:2-monogalactosyldiacylglycerol
+
** 5-amino-6-(d-ribitylamino)uracil
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
+
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** ynsrhgcgbfcdgk-rouqbacdsa-n
+
** xkqzixvjvupore-rpdrrwsusa-n
 
* molecular-weight:
 
* molecular-weight:
** 777.089
+
** 276.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[LUMAZINESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8366]]
+
* [[RIBOFLAVIN-SYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=5-amino-6-(d-ribitylamino)uracil}}
{{#set: inchi-key=inchikey=ynsrhgcgbfcdgk-rouqbacdsa-n}}
+
{{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}}
{{#set: molecular-weight=777.089}}
+
{{#set: molecular-weight=276.249}}

Revision as of 15:29, 5 January 2021

Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE

  • common-name:
    • 5-amino-6-(d-ribitylamino)uracil
  • smiles:
    • c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
  • inchi-key:
    • xkqzixvjvupore-rpdrrwsusa-n
  • molecular-weight:
    • 276.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality