Difference between revisions of "2-O-MeGuan-34-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=QOR-RXN QOR-RXN] == * direction: ** left-to-right * common-name: ** quinone oxidoreductase * ec-num...")
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=QOR-RXN QOR-RXN] ==
+
== Metabolite CPD-8166 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** quinone oxidoreductase
+
** 1-18:2-2-18:3-monogalactosyldiacylglycerol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.6.5.5 ec-1.6.5.5]
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
== Reaction formula ==
+
* inchi-key:
* 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Quinones]][c] '''=>''' 1 [[NADP]][c] '''+''' 2 [[Semiquinones]][c]
+
** drlqfbrxasrgdp-bubqrnscsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ20679]]
+
** 777.089
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8368]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-8367]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}}
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}}
** [http://www.genome.jp/dbget-bin/www_bget?R02364 R02364]
+
{{#set: molecular-weight=777.089}}
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P28304 P28304]
 
** [http://www.uniprot.org/uniprot/P38230 P38230]
 
** [http://www.uniprot.org/uniprot/P43903 P43903]
 
** [http://www.uniprot.org/uniprot/Q39172 Q39172]
 
** [http://www.uniprot.org/uniprot/Q39173 Q39173]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=quinone oxidoreductase}}
 
{{#set: ec-number=ec-1.6.5.5}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-8166

  • common-name:
    • 1-18:2-2-18:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • drlqfbrxasrgdp-bubqrnscsa-n
  • molecular-weight:
    • 777.089

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality