Difference between revisions of "2-O-Methylcytidine-32-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Mitochondrial-Preproteins == * common-name: ** a mitochondrial preprotein including a mitochondrial targeting sequence == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPD-520 == * common-name: ** quercetin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3))) * inchi-key: ** refjwtpedvj...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-520 == |
* common-name: | * common-name: | ||
− | ** | + | ** quercetin |
+ | * smiles: | ||
+ | ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3))) | ||
+ | * inchi-key: | ||
+ | ** refjwtpedvjjiy-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 301.232 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[3 | + | * [[QUERCETIN-23-DIOXYGENASE-RXN]] |
+ | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] | ||
+ | * [[RXN1F-462]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12510]] | ||
+ | * [[RXN-527]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=quercetin}} |
+ | {{#set: inchi-key=inchikey=refjwtpedvjjiy-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=301.232}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-520
- common-name:
- quercetin
- smiles:
- c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3)))
- inchi-key:
- refjwtpedvjjiy-uhfffaoysa-m
- molecular-weight:
- 301.232