Difference between revisions of "2-O-Methylcytidine-32-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inchi-key: ** krknybchxyngox-uhfffaoysa-k * molecul...")
(Created page with "Category:metabolite == Metabolite Double-Stranded-DNAs == * common-name: ** a double stranded dna == Reaction(s) known to consume the compound == * 5.99.1.3-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CIT ==
+
== Metabolite Double-Stranded-DNAs ==
 
* common-name:
 
* common-name:
** citrate
+
** a double stranded dna
* smiles:
 
** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
 
* inchi-key:
 
** krknybchxyngox-uhfffaoysa-k
 
* molecular-weight:
 
** 189.101
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[5.99.1.3-RXN]]
* [[AKGCITtm]]
 
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPCL]]
 
* [[OAACITtm]]
 
* [[RXN-14047]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[5.99.1.3-RXN]]
* [[AKGCITtm]]
 
* [[CITSYN-RXN]]
 
* [[CSm]]
 
* [[OAACITtm]]
 
* [[RXN-14047]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=citrate}}
+
{{#set: common-name=a double stranded dna}}
{{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}}
 
{{#set: molecular-weight=189.101}}
 

Revision as of 15:25, 5 January 2021

Metabolite Double-Stranded-DNAs

  • common-name:
    • a double stranded dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality