Difference between revisions of "2-O-Methylguanosine18"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-cytosine-1962 == * common-name: ** a cytosine1962 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11602 ==...")
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-cytosine-1962 ==
+
== Metabolite CPD-591 ==
 
* common-name:
 
* common-name:
** a cytosine1962 in 23s rrna
+
** cyanidin
 +
* smiles:
 +
** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
 +
* inchi-key:
 +
** vevzsmaejfvwil-uhfffaoysa-m
 +
* molecular-weight:
 +
** 285.232
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11602]]
+
* [[RXN-9725]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cytosine1962 in 23s rrna}}
+
{{#set: common-name=cyanidin}}
 +
{{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}}
 +
{{#set: molecular-weight=285.232}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-591

  • common-name:
    • cyanidin
  • smiles:
    • c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
  • inchi-key:
    • vevzsmaejfvwil-uhfffaoysa-m
  • molecular-weight:
    • 285.232

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality