Difference between revisions of "2-O-Methylguanosine18"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...") |
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-α-amino-ε-keto-pimelate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ukcsfklwnhubdy-bypyzucnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 188.16 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-α-amino-ε-keto-pimelate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=188.16}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE
- common-name:
- l-α-amino-ε-keto-pimelate
- smiles:
- c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
- inchi-key:
- ukcsfklwnhubdy-bypyzucnsa-m
- molecular-weight:
- 188.16
