Difference between revisions of "2-OCTAPRENYLPHENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ALANINE == * common-name: ** d-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key: ** qnaybmklocpygj-uwtatzphsa-n * molecular-weight: *...") |
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-OCTAPRENYLPHENOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-octaprenylphenol |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vunqjppptjiren-cmaxttdksa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 639.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2-OCTAPRENYLPHENOL-HYDROX-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-octaprenylphenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=639.058}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2-OCTAPRENYLPHENOL
- common-name:
- 2-octaprenylphenol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
- inchi-key:
- vunqjppptjiren-cmaxttdksa-n
- molecular-weight:
- 639.058
