Difference between revisions of "2-OCTAPRENYLPHENOL"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22113 == * transcription-direction: ** negative * right-end-position: ** 34045 * left-end-position: ** 29707 * centisome-position: ** 16.459175...") |
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2-OCTAPRENYLPHENOL == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-octaprenylphenol |
| − | + | * smiles: | |
| − | * | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c |
| − | + | * inchi-key: | |
| − | ** | + | ** vunqjppptjiren-cmaxttdksa-n |
| − | + | * molecular-weight: | |
| − | + | ** 639.058 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[2-OCTAPRENYLPHENOL-HYDROX-RXN]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2-octaprenylphenol}} | |
| − | ** | + | {{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}} |
| − | * | + | {{#set: molecular-weight=639.058}} |
| − | |||
| − | ** | ||
| − | * [[2 | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2-OCTAPRENYLPHENOL
- common-name:
- 2-octaprenylphenol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
- inchi-key:
- vunqjppptjiren-cmaxttdksa-n
- molecular-weight:
- 639.058
