Difference between revisions of "2-OCTAPRENYLPHENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * smiles: ** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(n...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
+
== Metabolite 2-OCTAPRENYLPHENOL ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-glucosamine
+
** 2-octaprenylphenol
 
* smiles:
 
* smiles:
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** lftytuazoprmmi-cfrasdgpsa-l
+
** vunqjppptjiren-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 605.342
+
** 639.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.101-RXN]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
* [[2.4.1.141-RXN]]
 
* [[2.4.1.145-RXN]]
 
* [[2.4.1.155-RXN]]
 
* [[2.4.1.198-RXN]]
 
* [[2.4.1.201-RXN]]
 
* [[2.4.1.223-RXN]]
 
* [[2.4.1.224-RXN]]
 
* [[2.4.1.229-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[2.7.8.15-RXN]]
 
* [[2.7.8.17-RXN]]
 
* [[RXN-11627]]
 
* [[RXN-11889]]
 
* [[RXN-11890]]
 
* [[RXN-15205]]
 
* [[RXN-6501]]
 
* [[RXN-7873]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.198-RXN]]
 
* [[2.4.1.229-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[NAG1P-URIDYLTRANS-RXN]]
 
* [[RXN-11627]]
 
* [[RXN-11889]]
 
* [[RXN-11890]]
 
* [[RXN-7873]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
+
{{#set: common-name=2-octaprenylphenol}}
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
+
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
{{#set: molecular-weight=605.342}}
+
{{#set: molecular-weight=639.058}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality