Difference between revisions of "2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5482 RXN-5482] == * direction: ** left-to-right * common-name: ** udp-l-rhamnose synthase == Re...")
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5482 RXN-5482] ==
+
== Metabolite 3-P-SERINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** udp-l-rhamnose synthase
+
** 3-phospho-l-serine
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-12575]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[UDP-L-RHAMNOSE]][c] '''+''' 1 [[WATER]][c]
+
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ16241]]
+
** bzqfbwgglxlepq-reohclbhsa-l
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
** 183.057
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[PSERTRANSAM-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-5114]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
{{#set: direction=left-to-right}}
+
* [[PSERTRANSAM-RXN]]
−
{{#set: common-name=udp-l-rhamnose synthase}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb gene associated=1}}
+
{{#set: common-name=3-phospho-l-serine}}
−
{{#set: nb pathway associated=0}}
+
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular-weight=183.057}}
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite 3-P-SERINE

  • common-name:
    • 3-phospho-l-serine
  • smiles:
    • c(op([o-])([o-])=o)c([n+])c(=o)[o-]
  • inchi-key:
    • bzqfbwgglxlepq-reohclbhsa-l
  • molecular-weight:
    • 183.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA&oldid=48175"