Difference between revisions of "2-OXOBUTANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...")
(Created page with "Category:metabolite == Metabolite 2-OXOBUTANOATE == * common-name: ** 2-oxobutanoate * smiles: ** ccc(=o)c(=o)[o-] * inchi-key: ** tyeybosbbbhjiv-uhfffaoysa-m * molecular-...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-GAMMA-GLUTAMYLCYSTEINE ==
+
== Metabolite 2-OXOBUTANOATE ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-l-cysteine
+
** 2-oxobutanoate
 
* smiles:
 
* smiles:
** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
+
** ccc(=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ritkhvbhsgluln-whfbiakzsa-m
+
** tyeybosbbbhjiv-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 249.261
+
** 101.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTATHIONE-SYN-RXN]]
+
* [[RXN-13719]]
* [[RXN-14430]]
+
* [[RXN-7790]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTCYSLIG-RXN]]
+
* [[4.1.99.4-RXN]]
 +
* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
 +
* [[HOMOSERDEAM-RXN]]
 +
* [[METBALT-RXN]]
 +
* [[RXN-13719]]
 +
* [[RXN-15130]]
 +
* [[RXN-7745]]
 +
* [[THREDEHYD-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-l-cysteine}}
+
{{#set: common-name=2-oxobutanoate}}
{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
+
{{#set: inchi-key=inchikey=tyeybosbbbhjiv-uhfffaoysa-m}}
{{#set: molecular-weight=249.261}}
+
{{#set: molecular-weight=101.082}}

Latest revision as of 11:16, 18 March 2021

Metabolite 2-OXOBUTANOATE

  • common-name:
    • 2-oxobutanoate
  • smiles:
    • ccc(=o)c(=o)[o-]
  • inchi-key:
    • tyeybosbbbhjiv-uhfffaoysa-m
  • molecular-weight:
    • 101.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality