Difference between revisions of "2-Oxo-carboxylates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
(Created page with "Category:metabolite == Metabolite 2-Oxo-carboxylates == * common-name: ** a 2-oxo carboxylate == Reaction(s) known to consume the compound == * 1.1.1.272-RXN * ALANI...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-2 ==
+
== Metabolite 2-Oxo-carboxylates ==
 
* common-name:
 
* common-name:
** (-)-methyl jasmonate
+
** a 2-oxo carboxylate
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 
* inchi-key:
 
** gewdntwnsazudx-wqmvxfaesa-n
 
* molecular-weight:
 
** 224.299
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10767]]
+
* [[1.1.1.272-RXN]]
 +
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13927]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.272-RXN]]
 +
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[L-AMINO-ACID-OXIDASE-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13927]]
 +
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-methyl jasmonate}}
+
{{#set: common-name=a 2-oxo carboxylate}}
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
 
{{#set: molecular-weight=224.299}}
 

Latest revision as of 11:13, 18 March 2021