Difference between revisions of "2-PG"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14441 == * transcription-direction: ** negative * right-end-position: ** 140435 * left-end-position: ** 124461 * centisome-position: ** 39.367954...") |
(Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2-PG == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-phospho-d-glycerate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])c(op(=o)([o-])[o-])co |
| − | * | + | * inchi-key: |
| − | ** | + | ** gxiurptvhjpjlf-uwtatzphsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 183.034 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
| − | == Reaction(s) | + | * [[3PGAREARR-RXN]] |
| − | * [[ | + | * [[RXN-15510]] |
| − | * | + | * [[RXN-15513]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2PGADEHYDRAT-RXN]] | |
| − | {{#set: | + | * [[3PGAREARR-RXN]] |
| − | + | * [[RXN-15510]] | |
| − | {{#set: | + | * [[RXN-15513]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2-phospho-d-glycerate}} | |
| + | {{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}} | ||
| + | {{#set: molecular-weight=183.034}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 2-PG
- common-name:
- 2-phospho-d-glycerate
- smiles:
- c(=o)([o-])c(op(=o)([o-])[o-])co
- inchi-key:
- gxiurptvhjpjlf-uwtatzphsa-k
- molecular-weight:
- 183.034
