Difference between revisions of "2-PG"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15687 == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c...") |
(Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-PG == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phospho-d-glycerate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c(op(=o)([o-])[o-])co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gxiurptvhjpjlf-uwtatzphsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 183.034 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2PGADEHYDRAT-RXN]] |
| + | * [[3PGAREARR-RXN]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15513]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2PGADEHYDRAT-RXN]] | ||
| + | * [[3PGAREARR-RXN]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15513]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phospho-d-glycerate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.034}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 2-PG
- common-name:
- 2-phospho-d-glycerate
- smiles:
- c(=o)([o-])c(op(=o)([o-])[o-])co
- inchi-key:
- gxiurptvhjpjlf-uwtatzphsa-k
- molecular-weight:
- 183.034
