Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ox-Thioredoxin == * common-name: ** an oxidized thioredoxin == Reaction(s) known to consume the compound == * 1.8.4.12-RXN * 1.8.4....")
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ox-Thioredoxin ==
+
== Metabolite DATP ==
 
* common-name:
 
* common-name:
** an oxidized thioredoxin
+
** datp
 +
* smiles:
 +
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 +
* inchi-key:
 +
** suyvubyjarfzho-rrkcrqdmsa-j
 +
* molecular-weight:
 +
** 487.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.12-RXN]]
+
* [[DATCY]]
* [[1.8.4.8-RXN]]
+
* [[DATPtm]]
* [[TDSR]]
+
* [[DATUP]]
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
+
* [[RXN-14195]]
 +
* [[RXN-14214]]
 +
* [[RXN0-384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.17.4.2-RXN]]
+
* [[DADPKIN-RXN]]
* [[1.8.4.12-RXN]]
+
* [[DATPtm]]
* [[1.8.4.14-RXN]]
+
* [[NDPK]]
* [[1.8.4.8-RXN]]
+
* [[NDPKm]]
* [[ADPREDUCT-RXN]]
+
* [[RXN-14192]]
* [[CDPREDUCT-RXN]]
+
* [[RXN0-745]]
* [[DAOTO]]
 
* [[DCDT]]
 
* [[DGOTO]]
 
* [[DUDT]]
 
* [[GDPREDUCT-RXN]]
 
* [[MERCAPYSTRANS-RXN]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 
* [[RXN-12019]]
 
* [[RXN-8668]]
 
* [[RXN0-267]]
 
* [[RXN0-5468]]
 
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oxidized thioredoxin}}
+
{{#set: common-name=datp}}
 +
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
 +
{{#set: molecular-weight=487.152}}

Revision as of 15:27, 5 January 2021

Metabolite DATP

  • common-name:
    • datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • suyvubyjarfzho-rrkcrqdmsa-j
  • molecular-weight:
    • 487.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality