Difference between revisions of "2-TRANS6-TRANS-FARNESAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite ACETYLCHOLINE == * common-name: ** acetylcholine * smiles: ** cc(=o)occ[n+](c)(c)c * inchi-key: ** oipilfwxsmykgl-uhfffaoysa-n * molecula...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9899 ==
+
== Metabolite ACETYLCHOLINE ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
+
** acetylcholine
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
+
** cc(=o)occ[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** dzwhypvptjpqqx-mycgwmctsa-m
+
** oipilfwxsmykgl-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 712.086
+
** 146.209
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYLCHOLINESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9280]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}}
+
{{#set: common-name=acetylcholine}}
{{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}}
+
{{#set: inchi-key=inchikey=oipilfwxsmykgl-uhfffaoysa-n}}
{{#set: molecular-weight=712.086}}
+
{{#set: molecular-weight=146.209}}

Revision as of 18:59, 14 January 2021

Metabolite ACETYLCHOLINE

  • common-name:
    • acetylcholine
  • smiles:
    • cc(=o)occ[n+](c)(c)c
  • inchi-key:
    • oipilfwxsmykgl-uhfffaoysa-n
  • molecular-weight:
    • 146.209

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality