Difference between revisions of "2-TRANS6-TRANS-FARNESAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...")
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PANTETHEINE-P ==
+
== Metabolite CPD-609 ==
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** p1,p4-bis(5'-guanosyl) tetraphosphate
 
* smiles:
 
* smiles:
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
 
* inchi-key:
 
* inchi-key:
** jdmuprlruumctl-vifpvbqesa-l
+
** olgwxcqxrssqpo-mharetsrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 356.33
+
** 864.359
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[3.6.1.17-RXN]]
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.14-RXN]]
 
* [[P-PANTOCYSDECARB-RXN]]
 
* [[PANTETHEINE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-phosphopantetheine}}
+
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
+
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
{{#set: molecular-weight=356.33}}
+
{{#set: molecular-weight=864.359}}

Revision as of 08:32, 15 March 2021

Metabolite CPD-609

  • common-name:
    • p1,p4-bis(5'-guanosyl) tetraphosphate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
  • inchi-key:
    • olgwxcqxrssqpo-mharetsrsa-j
  • molecular-weight:
    • 864.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality