Difference between revisions of "2-TRANS6-TRANS-FARNESAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
(Created page with "Category:metabolite == Metabolite 2-TRANS6-TRANS-FARNESAL == * common-name: ** (2e,6e)-farnesal * smiles: ** cc(c)=cccc(c)=cccc(c)=c[ch]=o * inchi-key: ** yhruhbbtqzkmex-y...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-TRANS6-TRANS-FARNESAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,6e)-farnesal |
* smiles: | * smiles: | ||
| − | ** cc(c | + | ** cc(c)=cccc(c)=cccc(c)=c[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yhruhbbtqzkmex-yfvjmotdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.354 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11623]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,6e)-farnesal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhruhbbtqzkmex-yfvjmotdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.354}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite 2-TRANS6-TRANS-FARNESAL
- common-name:
- (2e,6e)-farnesal
- smiles:
- cc(c)=cccc(c)=cccc(c)=c[ch]=o
- inchi-key:
- yhruhbbtqzkmex-yfvjmotdsa-n
- molecular-weight:
- 220.354
