Difference between revisions of "2-TRANS6-TRANS-FARNESAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...")
(Created page with "Category:metabolite == Metabolite 2-TRANS6-TRANS-FARNESAL == * common-name: ** (2e,6e)-farnesal * smiles: ** cc(c)=cccc(c)=cccc(c)=c[ch]=o * inchi-key: ** yhruhbbtqzkmex-y...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-609 ==
+
== Metabolite 2-TRANS6-TRANS-FARNESAL ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** (2e,6e)-farnesal
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
+
** cc(c)=cccc(c)=cccc(c)=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** olgwxcqxrssqpo-mharetsrsa-j
+
** yhruhbbtqzkmex-yfvjmotdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 864.359
+
** 220.354
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.17-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11623]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
{{#set: common-name=(2e,6e)-farnesal}}
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
+
{{#set: inchi-key=inchikey=yhruhbbtqzkmex-yfvjmotdsa-n}}
{{#set: molecular-weight=864.359}}
+
{{#set: molecular-weight=220.354}}

Latest revision as of 11:18, 18 March 2021

Metabolite 2-TRANS6-TRANS-FARNESAL

  • common-name:
    • (2e,6e)-farnesal
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=c[ch]=o
  • inchi-key:
    • yhruhbbtqzkmex-yfvjmotdsa-n
  • molecular-weight:
    • 220.354

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality