Difference between revisions of "2-TRANS6-TRANS-FARNESAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...") |
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9899 == |
* common-name: | * common-name: | ||
| − | ** 5 | + | ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dzwhypvptjpqqx-mycgwmctsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 712.086 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9280]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5 | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=712.086}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD-9899
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
- inchi-key:
- dzwhypvptjpqqx-mycgwmctsa-m
- molecular-weight:
- 712.086
