Difference between revisions of "2-hydroxyacyl-glutathiones"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite 2-hydroxyacyl-glutathiones == * common-name: ** s-(2-hydroxyacyl)glutathione == Reaction(s) known to consume the compound == * RXN-7919...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-hydroxyacyl-glutathiones == |
* common-name: | * common-name: | ||
− | ** ( | + | ** s-(2-hydroxyacyl)glutathione |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7919]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=s-(2-hydroxyacyl)glutathione}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 2-hydroxyacyl-glutathiones
- common-name:
- s-(2-hydroxyacyl)glutathione