Difference between revisions of "2-trans-4-cis-dienoyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15713 RXN-15713] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15713 RXN-15713] ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 6-phospho d-glucono-1,5-lactone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.5.1.7 ec-6.5.1.7]
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[3-Hydroxy-Terminated-DNAs]][c] '''+''' 1 [[5-Phospho-terminated-DNAs]][c] '''+''' 1 [[GTP]][c] '''=>''' 1 [[DNA-N]][c] '''+''' 1 [[GMP]][c] '''+''' 1 [[PPI]][c]
+
** ijojivndfqsgab-sqougzdysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15543]]
+
** 256.105
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[6PGLUCONOLACT-RXN]]
−
== Pathway(s)  ==
+
* [[RXN-14819]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[G6PADH]]
−
== External links  ==
+
* [[G6PADHh]]
−
{{#set: direction=left-to-right}}
+
* [[G6PBDH]]
−
{{#set: ec-number=ec-6.5.1.7}}
+
* [[G6PBDHh]]
−
{{#set: nb gene associated=1}}
+
* [[GLU6PDEHYDROG-RXN]]
−
{{#set: nb pathway associated=0}}
+
* [[RXN-14819]]
−
{{#set: reconstruction category=annotation}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
{{#set: molecular-weight=256.105}}

Revision as of 20:36, 18 December 2020

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • molecular-weight:
    • 256.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-trans-4-cis-dienoyl-CoAs&oldid=47787"