Difference between revisions of "23-DIPHOSPHOGLYCERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycerolipids == * common-name: ** a glycerolipid == Reaction(s) known to consume the compound == * RXN-16042 * RXN-16044 * RXN...") |
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23-DIPHOSPHOGLYCERATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2,3-diphospho-d-glycerate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** xohueycvluuejj-uwtatzphsa-i | ||
+ | * molecular-weight: | ||
+ | ** 260.998 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15509]] |
− | * [[RXN- | + | * [[RXN-15510]] |
− | * [[RXN- | + | * [[RXN-15511]] |
− | * [[RXN- | + | * [[RXN-15512]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
− | + | * [[RXN-15509]] | |
− | + | * [[RXN-15510]] | |
− | + | * [[RXN-15511]] | |
− | + | * [[RXN-15512]] | |
− | + | * [[RXN-17276]] | |
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2,3-diphospho-d-glycerate}} |
+ | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} | ||
+ | {{#set: molecular-weight=260.998}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- molecular-weight:
- 260.998