Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Semiquinones == * common-name: ** a semiquinone == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compo...") |
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == |
* common-name: | * common-name: | ||
− | ** | + | ** vitamin k 2,3-epoxide |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3) | ||
+ | * inchi-key: | ||
+ | ** kutxfbihpwidjq-hbdfacptsa-n | ||
+ | * molecular-weight: | ||
+ | ** 466.703 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.1.4.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.1.4.1-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=vitamin k 2,3-epoxide}} |
+ | {{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}} | ||
+ | {{#set: molecular-weight=466.703}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ
- common-name:
- vitamin k 2,3-epoxide
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
- inchi-key:
- kutxfbihpwidjq-hbdfacptsa-n
- molecular-weight:
- 466.703