Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.2-RXN 1.2.1.2-RXN] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC...")
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.2-RXN 1.2.1.2-RXN] ==
+
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
−
* direction:
+
* common-name:
−
** reversible
+
** vitamin k 2,3-epoxide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.17.1.9 ec-1.17.1.9]
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[FORMATE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c]
+
** kutxfbihpwidjq-hbdfacptsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13526]]
+
** 466.703
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.1.4.1-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-1881]], formate oxidation to CO2: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1881 PWY-1881]
+
* [[1.1.4.1-RXN]]
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
{{#set: common-name=vitamin k 2,3-epoxide}}
−
** '''10''' reactions found over '''24''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
−
* [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY]
+
{{#set: molecular-weight=466.703}}
−
** '''6''' reactions found over '''17''' reactions in the full pathway
 
−
* [[PWY-6696]], oxalate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6696 PWY-6696]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15988 15988]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00519 R00519]
 
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-1.17.1.9}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ

  • common-name:
    • vitamin k 2,3-epoxide
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
  • inchi-key:
    • kutxfbihpwidjq-hbdfacptsa-n
  • molecular-weight:
    • 466.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ&oldid=139171"