Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-FORMIMINO-L-GLUTAMATE == * common-name: ** n-formimino-l-glutamate * smiles: ** [ch](=[n+])nc(c([o-])=o)ccc([o-])=o * inchi-key: ** nrx...")
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite N-FORMIMINO-L-GLUTAMATE ==
+
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
 
* common-name:
 
* common-name:
−
** n-formimino-l-glutamate
+
** vitamin k 2,3-epoxide
 
* smiles:
 
* smiles:
−
** [ch](=[n+])nc(c([o-])=o)ccc([o-])=o
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
 
* inchi-key:
 
* inchi-key:
−
** nrxikwmtvxpvef-bypyzucnsa-m
+
** kutxfbihpwidjq-hbdfacptsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 173.148
+
** 466.703
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]]
+
* [[1.1.4.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.4.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=n-formimino-l-glutamate}}
+
{{#set: common-name=vitamin k 2,3-epoxide}}
−
{{#set: inchi-key=inchikey=nrxikwmtvxpvef-bypyzucnsa-m}}
+
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
−
{{#set: molecular-weight=173.148}}
+
{{#set: molecular-weight=466.703}}

Latest revision as of 11:16, 18 March 2021

Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ

  • common-name:
    • vitamin k 2,3-epoxide
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
  • inchi-key:
    • kutxfbihpwidjq-hbdfacptsa-n
  • molecular-weight:
    • 466.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ&oldid=139171"