Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-196 ==
+== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
 * common-name:
-** octanoyl-coa
+** vitamin k 2,3-epoxide
 * smiles:
-** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
 * inchi-key:
-** kqmzyoxobsxmii-cecatxlmsa-j
+** kutxfbihpwidjq-hbdfacptsa-n
 * molecular-weight:
-** 889.7
+** 466.703
 == Reaction(s) known to consume the compound ==
-* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+* [[1.1.4.1-RXN]]
-* [[ACACT4]]
-* [[ACACT4h]]
-* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
-* [[ACOA80OR]]
-* [[RXN-12669]]
-* [[RXN-14229]]
-* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
 == Reaction(s) known to produce the compound ==
-* [[ACACT4]]
+* [[1.1.4.1-RXN]]
-* [[R223-RXN]]
-* [[RXN-13617]]
-* [[RXN-14229]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=octanoyl-coa}}
+{{#set: common-name=vitamin k 2,3-epoxide}}
-{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
+{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
-{{#set: molecular-weight=889.7}}
+{{#set: molecular-weight=466.703}}