Difference between revisions of "23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOACYLASE-RXN AMINOACYLASE-RXN] == * direction: ** left-to-right * common-name: ** aminoacylase...")
 
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOACYLASE-RXN AMINOACYLASE-RXN] ==
+
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** aminoacylase
+
** vitamin k 2,3-epoxide
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.1.14 ec-3.5.1.14]
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[N-Acylated-Aliphatic-Amino-Acids]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Aliphatic-L-Amino-Acids]][c] '''+''' 1 [[Carboxylates]][c]
+
** kutxfbihpwidjq-hbdfacptsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09884]]
+
** 466.703
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.4.1-RXN]]
−
* Gene: [[SJ21981]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[1.1.4.1-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=vitamin k 2,3-epoxide}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=466.703}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15565 15565]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01263 R01263]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q03154 Q03154]
 
−
** [http://www.uniprot.org/uniprot/Q8X8Q0 Q8X8Q0]
 
−
** [http://www.uniprot.org/uniprot/P72349 P72349]
 
−
** [http://www.uniprot.org/uniprot/P37111 P37111]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=aminoacylase}}
 
−
{{#set: ec-number=ec-3.5.1.14}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ

  • common-name:
    • vitamin k 2,3-epoxide
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
  • inchi-key:
    • kutxfbihpwidjq-hbdfacptsa-n
  • molecular-weight:
    • 466.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ&oldid=139171"