Difference between revisions of "23S-RRNA-N2-METHYLGUANINE2445"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.126-RXN 2.1.1.126-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy...")
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.126-RXN 2.1.1.126-RXN] ==
+
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.321 ec-2.1.1.321]
+
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Myelin-L-arginines]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[Myelin-N-o-methyl-arginines]][c] '''+''' 1 [[PROTON]][c]
+
** vxpbdcbtmskckz-xqhnhvhjsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16975]]
+
** 351.462
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.1.197-RXN]]
−
* Gene: [[SJ15815]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[1.1.1.197-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=351.462}}
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04719 R04719]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.1.1.321}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1

  • common-name:
    • (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
  • smiles:
    • cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
  • inchi-key:
    • vxpbdcbtmskckz-xqhnhvhjsa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23S-RRNA-N2-METHYLGUANINE2445&oldid=48556"