Difference between revisions of "23S-rRNA-2-methyladenine2503"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite dicarboxylate == * common-name: ** a dicarboxylate == Reaction(s) known to consume the compound == * OMEGA-AMIDASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite dicarboxylate ==
+
== Metabolite CPD-10792 ==
 
* common-name:
 
* common-name:
** a dicarboxylate
+
** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
 +
* smiles:
 +
** cc(=o)c(o)c(o)cc([n+])c([o-])=o
 +
* inchi-key:
 +
** ifmhgoadxgywmo-kvqbguixsa-n
 +
* molecular-weight:
 +
** 191.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OMEGA-AMIDASE-RXN]]
+
* [[RXN-10032]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OMEGA-AMIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dicarboxylate}}
+
{{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}}
 +
{{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}}
 +
{{#set: molecular-weight=191.183}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-10792

  • common-name:
    • 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
  • smiles:
    • cc(=o)c(o)c(o)cc([n+])c([o-])=o
  • inchi-key:
    • ifmhgoadxgywmo-kvqbguixsa-n
  • molecular-weight:
    • 191.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality