Difference between revisions of "23S-rRNA-5-methylcytosine1962"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-5-methylcytosine1962 == * common-name: ** a 5-methylcytosine1962 in 23s rrna == Reaction(s) known to consume the compound == ==...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23S-rRNA-5-methylcytosine1962 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5-methylcytosine1962 in 23s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11602]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5-methylcytosine1962 in 23s rrna}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 23S-rRNA-5-methylcytosine1962
- common-name:
- a 5-methylcytosine1962 in 23s rrna