Difference between revisions of "23S-rRNA-5-methyluracil1939"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-5-methyluracil1939 == * common-name: ** a 5-methyluracil1939 in 23s rrna == Reaction(s) known to consume the compound == == Reac...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-5-methyluracil1939 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-methyluracil1939 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11601]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-methyluracil1939 in 23s rrna}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 23S-rRNA-5-methyluracil1939
- common-name:
- a 5-methyluracil1939 in 23s rrna
