Difference between revisions of "23S-rRNA-adenine-2503"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate * smiles: ** c(op([o-])...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-adenine-2503 == * common-name: ** adenine2503 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11586 == Rea...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE ==
+
== Metabolite 23S-rRNA-adenine-2503 ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** adenine2503 in 23s rrna
* smiles:
 
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
 
* inchi-key:
 
** xfvulmdjzxymsg-ziyngmlesa-k
 
* molecular-weight:
 
** 336.174
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[RXN-11586]]
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
{{#set: common-name=adenine2503 in 23s rrna}}
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
 
{{#set: molecular-weight=336.174}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 23S-rRNA-adenine-2503

  • common-name:
    • adenine2503 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality