Difference between revisions of "23S-rRNA-adenine-2503"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-Octenoyl-ACPs == * common-name: ** a trans oct-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9526 * RXN-965...") |
(Created page with "Category:metabolite == Metabolite CPD-14646 == * common-name: ** 9-cis-β-carotene * smiles: ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14646 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9-cis-β-carotene |
| + | * smiles: | ||
| + | ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c | ||
| + | * inchi-key: | ||
| + | ** oenhqhleoonyie-bvzamqqesa-n | ||
| + | * molecular-weight: | ||
| + | ** 536.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13641]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13641]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9-cis-β-carotene}} |
| + | {{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}} | ||
| + | {{#set: molecular-weight=536.882}} | ||
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-14646
- common-name:
- 9-cis-β-carotene
- smiles:
- cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
- inchi-key:
- oenhqhleoonyie-bvzamqqesa-n
- molecular-weight:
- 536.882
