Difference between revisions of "23S-rRNA-guanine-2069"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-2069 == * common-name: ** a guanine2069 in 23s rrna == Reaction(s) known to consume the compound == * RXN0-6950 == R...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20680 ==
+
== Metabolite 23S-rRNA-guanine-2069 ==
 
* common-name:
 
* common-name:
** diadinoxanthin
+
** a guanine2069 in 23s rrna
* smiles:
 
** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
 
* inchi-key:
 
** oghzcsinimwcsb-ghiqlmqgsa-n
 
* molecular-weight:
 
** 582.865
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19200]]
+
* [[RXN0-6950]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19202]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=diadinoxanthin}}
+
{{#set: common-name=a guanine2069 in 23s rrna}}
{{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}}
 
{{#set: molecular-weight=582.865}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 23S-rRNA-guanine-2069

  • common-name:
    • a guanine2069 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality