Difference between revisions of "23S-rRNA-guanine-2069"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05357 == * transcription-direction: ** negative * right-end-position: ** 293019 * left-end-position: ** 288900 * centisome-position: ** 58.19716...")
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05357 ==
+
== Metabolite O-SUCCINYL-L-HOMOSERINE ==
* transcription-direction:
+
* common-name:
** negative
+
** o-succinyl-l-homoserine
* right-end-position:
+
* smiles:
** 293019
+
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 288900
+
** gnisqjgxjidkdj-yfkpbyrvsa-m
* centisome-position:
+
* molecular-weight:
** 58.19716   
+
** 218.186
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[METBALT-RXN]]
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[HOMOSERDEAM-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[LCYSDESULF-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
** Category: [[annotation]]
+
* [[RXN-9384]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[SUCHMSSELCYSL]]
* [[RXN-14048]]
+
* [[SUCHMSSELCYSLh]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HOMSUCTRAN-RXN]]
* [[RXN-14049]]
+
* [[O-SUCCHOMOSERLYASE-RXN]]
** Category: [[annotation]]
+
* [[RXN-9384]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-15129]]
+
{{#set: common-name=o-succinyl-l-homoserine}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=218.186}}
* [[RXN-15130]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY66-426]]
 
** '''2''' reactions found over '''6''' reactions in the full pathway
 
* [[HOMOSER-METSYN-PWY]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-I9]]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-801]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[HOMOCYSDEGR-PWY]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[LCYSDEG-PWY]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=293019}}
 
{{#set: left-end-position=288900}}
 
{{#set: centisome-position=58.19716    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=7}}
 
{{#set: nb pathway associated=6}}
 

Revision as of 20:31, 18 December 2020

Metabolite O-SUCCINYL-L-HOMOSERINE

  • common-name:
    • o-succinyl-l-homoserine
  • smiles:
    • c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
  • inchi-key:
    • gnisqjgxjidkdj-yfkpbyrvsa-m
  • molecular-weight:
    • 218.186

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality