Difference between revisions of "23S-rRNA-guanine-2069"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05357 == * transcription-direction: ** negative * right-end-position: ** 293019 * left-end-position: ** 288900 * centisome-position: ** 58.19716...") |
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite O-SUCCINYL-L-HOMOSERINE == |
− | * | + | * common-name: |
− | ** | + | ** o-succinyl-l-homoserine |
− | + | * smiles: | |
− | + | ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o | |
− | + | * inchi-key: | |
− | + | ** gnisqjgxjidkdj-yfkpbyrvsa-m | |
− | * | + | * molecular-weight: |
− | ** | + | ** 218.186 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[METBALT-RXN]] | |
− | |||
− | |||
− | * | ||
− | * | ||
− | ** | ||
− | * [[ | ||
− | |||
− | |||
* [[O-SUCCHOMOSERLYASE-RXN]] | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
− | + | * [[RXN-9384]] | |
− | + | * [[SUCHMSSELCYSL]] | |
− | + | * [[SUCHMSSELCYSLh]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[HOMSUCTRAN-RXN]] | |
− | + | * [[O-SUCCHOMOSERLYASE-RXN]] | |
− | + | * [[RXN-9384]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=o-succinyl-l-homoserine}} | |
− | + | {{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}} | |
− | + | {{#set: molecular-weight=218.186}} | |
− | * [[RXN- | ||
− | * | ||
− | * | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- common-name:
- o-succinyl-l-homoserine
- smiles:
- c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
- inchi-key:
- gnisqjgxjidkdj-yfkpbyrvsa-m
- molecular-weight:
- 218.186