Difference between revisions of "23S-rRNA-guanine-2445"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite m7G5-pppAm-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyladenosine)-[mrna] == Reaction(s) known to consu...") |
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9245 == |
* common-name: | * common-name: | ||
| − | ** | + | ** palmitoleate |
| + | * smiles: | ||
| + | ** ccccccc=ccccccccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** secpzkhbenqxjg-fplpwbnlsa-m | ||
| + | * molecular-weight: | ||
| + | ** 253.404 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-7248]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10662]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=palmitoleate}} |
| + | {{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}} | ||
| + | {{#set: molecular-weight=253.404}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-9245
- common-name:
- palmitoleate
- smiles:
- ccccccc=ccccccccc(=o)[o-]
- inchi-key:
- secpzkhbenqxjg-fplpwbnlsa-m
- molecular-weight:
- 253.404
