Difference between revisions of "23S-rRNA-guanine-2445"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...") |
(Created page with "Category:metabolite == Metabolite CYCLOARTENOL == * common-name: ** cycloartenol * smiles: ** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5)))) *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CYCLOARTENOL == |
* common-name: | * common-name: | ||
− | ** | + | ** cycloartenol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** onqrkeuaijmulo-coenlipysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 426.724 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-21829]] |
+ | * [[RXN-4021]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[CYCLOARTENOL-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cycloartenol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=onqrkeuaijmulo-coenlipysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=426.724}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CYCLOARTENOL
- common-name:
- cycloartenol
- smiles:
- cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
- inchi-key:
- onqrkeuaijmulo-coenlipysa-n
- molecular-weight:
- 426.724