Difference between revisions of "23S-rRNA-guanine-2445"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-2445 == * common-name: ** a guanine2445 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11574 == R...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9245 ==
+
== Metabolite 23S-rRNA-guanine-2445 ==
 
* common-name:
 
* common-name:
** palmitoleate
+
** a guanine2445 in 23s rrna
* smiles:
 
** ccccccc=ccccccccc(=o)[o-]
 
* inchi-key:
 
** secpzkhbenqxjg-fplpwbnlsa-m
 
* molecular-weight:
 
** 253.404
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-7248]]
+
* [[RXN-11574]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10662]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleate}}
+
{{#set: common-name=a guanine2445 in 23s rrna}}
{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
 
{{#set: molecular-weight=253.404}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 23S-rRNA-guanine-2445

  • common-name:
    • a guanine2445 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality