Difference between revisions of "23S-rRNA-guanine-2445"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-2445 == * common-name: ** a guanine2445 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11574 == R...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23S-rRNA-guanine-2445 == |
* common-name: | * common-name: | ||
− | ** | + | ** a guanine2445 in 23s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11574]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a guanine2445 in 23s rrna}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 23S-rRNA-guanine-2445
- common-name:
- a guanine2445 in 23s rrna