Difference between revisions of "23S-rRNA-pseudouridine1911-1915-1917"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-PHOSPHONOOXY-THREONINE == * common-name: ** 4-phosphooxy-l-threonine * smiles: ** c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-] * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Oxidized-NrdH-Proteins == * common-name: ** an oxidized nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oxidized-NrdH-Proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oxidized nrdh glutaredoxin-like protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] |
| + | * [[RXN0-722]] | ||
| + | * [[RXN0-747]] | ||
| + | * [[RXN0-748]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oxidized nrdh glutaredoxin-like protein}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Oxidized-NrdH-Proteins
- common-name:
- an oxidized nrdh glutaredoxin-like protein
