Difference between revisions of "23S-rRNA-pseudouridine1915"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17150 RXN-17150] == * direction: ** left-to-right * common-name: ** n-formyl-β-hydroxy-l-k...")
(Created page with "Category:metabolite == Metabolite CPD-17045 == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17150 RXN-17150] ==
+
== Metabolite CPD-17045 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** n-formyl-β-hydroxy-l-kynurenine formamidas
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.1.9 ec-3.5.1.9]
+
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-18539]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-18532]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c]
+
** pxypzmrmtkvysm-vxgbxaggsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ22183]]
+
** 266.253
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-15680]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7733]], 3-hydroxyquinaldate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7733 PWY-7733]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
* [[PWY-7734]], quinoxaline-2-carboxylate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7734 PWY-7734]
+
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
−
** '''1''' reactions found over '''10''' reactions in the full pathway
+
{{#set: molecular-weight=266.253}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=n-formyl-β-hydroxy-l-kynurenine formamidas}}
 
−
{{#set: ec-number=ec-3.5.1.9}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-17045

  • common-name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
  • inchi-key:
    • pxypzmrmtkvysm-vxgbxaggsa-n
  • molecular-weight:
    • 266.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23S-rRNA-pseudouridine1915&oldid=48210"